Products 888022-63-7
CAS 888022-63-7 appears in our catalog under these names: 2-Chloro-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%, 2-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 888022-63-7) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 2-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: GOZXORRGNFHRGE-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 2-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | GOZXORRGNFHRGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OCC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)