CAS 1272528-86-5 appears in our catalog under these names: 3-Chloro-4-methoxy-5-(trifluoromethyl)benzoic acid, 95%, 3-Chloro-4-methoxy-5-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid (CAS 1272528-86-5) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid. InChIKey: JDVPVUPAFTXQDR-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 3-chloro-4-methoxy-5-(trifluoromethyl)benzoic acid |
| InChIKey | JDVPVUPAFTXQDR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)