Products 886502-42-7
CAS 886502-42-7 is the registry number for 4-Methoxy-2-(trifluoromethoxy)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-methoxy-2-(trifluoromethoxy)benzoyl chloride (CAS 886502-42-7) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethoxy)benzoyl chloride. InChIKey: XTRNPLXMVUIGGU-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 4-methoxy-2-(trifluoromethoxy)benzoyl chloride |
| InChIKey | XTRNPLXMVUIGGU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)