CAS 1192829-76-7 is the registry number for 3-Chloro-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 1192829-76-7) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: 3-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: TWUYFBPOUABLQW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | 3-chloro-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | TWUYFBPOUABLQW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)OCC(F)(F)F |
Computed by PubChem (NCBI)