Products 1261649-12-0
CAS 1261649-12-0 appears in our catalog under these names: Methyl 2-chloro-5-(trifluoromethoxy)benzoate, 95%, Methyl 2-chloro-5-(trifluoromethoxy)benzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Methyl 2-chloro-5-(trifluoromethoxy)benzoate (CAS 1261649-12-0) is a chemical compound with the molecular formula C9H6ClF3O3 and a molecular weight of 254.59 g/mol. IUPAC name: methyl 2-chloro-5-(trifluoromethoxy)benzoate. InChIKey: XICATXXOOIQRRD-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O3 |
|---|---|
| Molecular weight | 254.59 g/mol |
| IUPAC name | methyl 2-chloro-5-(trifluoromethoxy)benzoate |
| InChIKey | XICATXXOOIQRRD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)OC(F)(F)F)Cl |
Computed by PubChem (NCBI)