cas: 6332-83-8 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-1-phenylethanone, 98%, 98% (CAS 6332-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EEJU-100mg |
| cas | 6332-83-8 |
| size | 100mg |
| availability | 10.67g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 678.80 Pln | |
| Chemat | 10g | 1230.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-chlorophenyl)-1-phenylethanone (CAS 6332-83-8) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-phenylethanone. InChIKey: HGIDMJOUQKOWMX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-phenylethanone |
| InChIKey | HGIDMJOUQKOWMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)