cas: 6332-83-8 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)acetophenone 98% (CAS 6332-83-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A673139-100mg |
| cas | 6332-83-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 804.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A673139 |
2-(4-chlorophenyl)-1-phenylethanone (CAS 6332-83-8) is a chemical compound with the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. IUPAC name: 2-(4-chlorophenyl)-1-phenylethanone. InChIKey: HGIDMJOUQKOWMX-UHFFFAOYSA-N.
| Molecular formula | C14H11ClO |
|---|---|
| Molecular weight | 230.69 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1-phenylethanone |
| InChIKey | HGIDMJOUQKOWMX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)