cas: 22815-98-1 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-5-methyl-1,3,4-oxadiazole 98% (CAS 22815-98-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A313765-100mg |
| cas | 22815-98-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 765.31 Pln | |
| Ambeed | 1g | 1494.00 Pln | |
| Ambeed | 5g | 4392.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A313765 |
2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole (CAS 22815-98-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: IWHCZNKJMUMKTL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | IWHCZNKJMUMKTL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)