cas: 22815-98-1 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)-5-methyl-1,3,4-oxadiazole, 98% (CAS 22815-98-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F731138-100MG |
| cas | 22815-98-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 466.52 Pln | |
| Fluorochem | 250mg | 758.08 Pln | |
| Fluorochem | 1g | 1486.99 Pln | |
| Fluorochem | 5g | 4402.63 Pln | |
| Fluorochem | 10g | 7432.82 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole (CAS 22815-98-1) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole. InChIKey: IWHCZNKJMUMKTL-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-methyl-1,3,4-oxadiazole |
| InChIKey | IWHCZNKJMUMKTL-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(O1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)