cas: 7386-21-2 — see every product listed under this CAS number, including other names
2-(4-Chlorophenyl)isoindoline-1,3-dione (CAS 7386-21-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F775808-250MG |
| cas | 7386-21-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 351.98 Pln | |
| Fluorochem | 25g | 1039.24 Pln | |
| Fluorochem | 100g | 2976.05 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-chlorophenyl)isoindole-1,3-dione (CAS 7386-21-2) is a chemical compound with the molecular formula C14H8ClNO2 and a molecular weight of 257.67 g/mol. IUPAC name: 2-(4-chlorophenyl)isoindole-1,3-dione. InChIKey: QKHKQJWODBAIMN-UHFFFAOYSA-N.
| Molecular formula | C14H8ClNO2 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | 2-(4-chlorophenyl)isoindole-1,3-dione |
| InChIKey | QKHKQJWODBAIMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)