cas: 1255945-85-7 — see every product listed under this CAS number, including other names
2-(4-Fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetic acid 97% (CAS 1255945-85-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A120379-100mg |
| cas | 1255945-85-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 4620.12 Pln | |
| Ambeed | 25g | 12858.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A120379 |
2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid (CAS 1255945-85-7) is a chemical compound with the molecular formula C14H18BFO4 and a molecular weight of 280.10 g/mol. IUPAC name: 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid. InChIKey: DYFNQNVMHCQXDI-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO4 |
|---|---|
| Molecular weight | 280.10 g/mol |
| IUPAC name | 2-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetic acid |
| InChIKey | DYFNQNVMHCQXDI-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)CC(=O)O)F |
Computed by PubChem (NCBI)