cas: 54629-13-9 — see every product listed under this CAS number, including other names
2-(4-Fluorophenoxy)nicotinic acid, 97% (CAS 54629-13-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 25g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | TL00878DA |
| cas | 54629-13-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 1g | 59.05 Pln | |
| Thermo Scientific | 10g | 419.99 Pln | |
| Thermo Scientific | 25g | 931.62 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
2-(4-fluorophenoxy)pyridine-3-carboxylic acid (CAS 54629-13-9) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 2-(4-fluorophenoxy)pyridine-3-carboxylic acid. InChIKey: SDZUYDOXBXHDCE-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)pyridine-3-carboxylic acid |
| InChIKey | SDZUYDOXBXHDCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)