CAS 1284640-83-0 appears in our catalog under these names: 1-(2-Fluorophenyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid, 95%, 1-(2-Fluorophenyl)-6-oxo-1,6-dihydropyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2-fluorophenyl)-6-oxopyridine-3-carboxylic acid (CAS 1284640-83-0) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 1-(2-fluorophenyl)-6-oxopyridine-3-carboxylic acid. InChIKey: OCUYDWJEADJYLB-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-6-oxopyridine-3-carboxylic acid |
| InChIKey | OCUYDWJEADJYLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(C=CC2=O)C(=O)O)F |
Computed by PubChem (NCBI)