Products 1261895-92-4

CAS 1261895-92-4 is the registry number for 4-(4-Carboxy-3-fluorophenyl)-2-hydroxypyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-fluoro-4-(2-oxo-1H-pyridin-4-yl)benzoic acid (CAS 1261895-92-4) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 2-fluoro-4-(2-oxo-1H-pyridin-4-yl)benzoic acid. InChIKey: PSQUIRHEVMTHOJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8FNO3
Molecular weight233.19 g/mol
IUPAC name2-fluoro-4-(2-oxo-1H-pyridin-4-yl)benzoic acid
InChIKeyPSQUIRHEVMTHOJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=O)NC=C2)F)C(=O)O

Computed by PubChem (NCBI)