CAS 34859-79-5 appears in our catalog under these names: 1-fluoro-3-(4-nitrophenoxy)benzene, 95%, 1-Fluoro-3-(4-nitrophenoxy)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-fluoro-3-(4-nitrophenoxy)benzene (CAS 34859-79-5) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 1-fluoro-3-(4-nitrophenoxy)benzene. InChIKey: KEPNOAVJAHCJDK-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 1-fluoro-3-(4-nitrophenoxy)benzene |
| InChIKey | KEPNOAVJAHCJDK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)