CAS 54629-13-9 appears in our catalog under these names: 2-(4-Fluorophenoxy)nicotinic acid, 95%, 2-(4-Fluorophenoxy)nicotinic acid, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 10g, 25g.
2-(4-fluorophenoxy)pyridine-3-carboxylic acid (CAS 54629-13-9) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 2-(4-fluorophenoxy)pyridine-3-carboxylic acid. InChIKey: SDZUYDOXBXHDCE-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)pyridine-3-carboxylic acid |
| InChIKey | SDZUYDOXBXHDCE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)OC2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)