Products 1261919-94-1
CAS 1261919-94-1 appears in our catalog under these names: 2-(4-Fluoro-2-hydroxyphenyl)isonicotinic acid, 95%, 2-(4-Fluoro-2-hydroxyphenyl)isonicotinic acid (~90%). Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 1g, 250mg, 25mg, 5g.
2-(4-fluoro-2-hydroxyphenyl)pyridine-4-carboxylic acid (CAS 1261919-94-1) is a chemical compound with the molecular formula C12H8FNO3 and a molecular weight of 233.19 g/mol. IUPAC name: 2-(4-fluoro-2-hydroxyphenyl)pyridine-4-carboxylic acid. InChIKey: QRFYUJGNTRMAKM-UHFFFAOYSA-N.
| Molecular formula | C12H8FNO3 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | 2-(4-fluoro-2-hydroxyphenyl)pyridine-4-carboxylic acid |
| InChIKey | QRFYUJGNTRMAKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)O)C2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)