cas: 502649-34-5 — see every product listed under this CAS number, including other names
2-(4-ISOPROPOXYPHENYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE, 98%, 98% (CAS 502649-34-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9ZN-1g |
| cas | 502649-34-5 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 894.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,4,5,5-tetramethyl-2-(4-propan-2-yloxyphenyl)-1,3,2-dioxaborolane (CAS 502649-34-5) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(4-propan-2-yloxyphenyl)-1,3,2-dioxaborolane. InChIKey: LSMVUNSQZOHKJB-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(4-propan-2-yloxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | LSMVUNSQZOHKJB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC(C)C |
Computed by PubChem (NCBI)