CAS 1309980-11-7 appears in our catalog under these names: 3-(2-Hydroxypropan-2-yl)phenylboronic acid pinacol ester, 97%, 3–(2–Hydroxy–2–propanyl)phenylboronic acid pinacol ester, 2-(3-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propan-2-ol, 95%, 95%, 3-(2-Hydroxypropan-2-yl)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol (CAS 1309980-11-7) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol. InChIKey: NNPQWBXXZHNLAW-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-ol |
| InChIKey | NNPQWBXXZHNLAW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(C)(C)O |
Computed by PubChem (NCBI)