CAS 915402-04-9 appears in our catalog under these names: 2,3-Dimethyl-4-methoxyphenylboronic acid, pinacol ester, 98%, 2,3-Dimethyl-4-methoxyphenylboronic acid, pinacol ester, 98%, 98%, 2-(4-Methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g.
2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 915402-04-9) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TXIXUBXWDMWIEQ-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TXIXUBXWDMWIEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)C)C |
Computed by PubChem (NCBI)