Products 1689469-59-7
CAS 1689469-59-7 appears in our catalog under these names: 4,4,5,5-tetramethyl-2-(3-propoxyphenyl)-1,3,2-dioxaborolane, 95%, 4,4,5,5-Tetramethyl-2-(3-propoxyphenyl)-1,3,2-dioxaborolane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 2,5g.
4,4,5,5-tetramethyl-2-(3-propoxyphenyl)-1,3,2-dioxaborolane (CAS 1689469-59-7) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-propoxyphenyl)-1,3,2-dioxaborolane. InChIKey: GCWKKLLIVKKVDL-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-propoxyphenyl)-1,3,2-dioxaborolane |
| InChIKey | GCWKKLLIVKKVDL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCCC |
Computed by PubChem (NCBI)