Products 2377611-17-9

CAS 2377611-17-9 is the registry number for 4-Nonanoylphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(4-nonanoylphenyl)boronic acid (CAS 2377611-17-9) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: (4-nonanoylphenyl)boronic acid. InChIKey: UDSDQFURDMVPQW-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23BO3
Molecular weight262.15 g/mol
IUPAC name(4-nonanoylphenyl)boronic acid
InChIKeyUDSDQFURDMVPQW-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C(=O)CCCCCCCC)(O)O

Computed by PubChem (NCBI)