Products 2246830-10-2
CAS 2246830-10-2 is the registry number for 2-(3-Ethoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(3-ethoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246830-10-2) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 2-(3-ethoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VXZCUCVDTRSGPM-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 2-(3-ethoxy-4-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VXZCUCVDTRSGPM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C)OCC |
Computed by PubChem (NCBI)