cas: 915402-04-9 — see every product listed under this CAS number, including other names
2-(4-Methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 915402-04-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A189612-100mg |
| cas | 915402-04-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 253.56 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1087.94 Pln | |
| Ambeed | 25g | 5120.75 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A189612 |
2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 915402-04-9) is a chemical compound with the molecular formula C15H23BO3 and a molecular weight of 262.15 g/mol. IUPAC name: 2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: TXIXUBXWDMWIEQ-UHFFFAOYSA-N.
| Molecular formula | C15H23BO3 |
|---|---|
| Molecular weight | 262.15 g/mol |
| IUPAC name | 2-(4-methoxy-2,3-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | TXIXUBXWDMWIEQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=C(C=C2)OC)C)C |
Computed by PubChem (NCBI)