2-(4-Nitrophenyl)-1,3,2-dioxaborinane, 98%
cas: 85107-43-3 — see every product listed under this CAS number, including other names
2-(4-Nitrophenyl)-1,3,2-dioxaborinane, 98% (CAS 85107-43-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1461193-250mg |
| cas | 85107-43-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 606.80 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 475.41 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-(4-nitrophenyl)-1,3,2-dioxaborinane (CAS 85107-43-3) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: 2-(4-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: XDVUGAYZMIDGEX-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | XDVUGAYZMIDGEX-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)