CAS 1266084-47-2 appears in our catalog under these names: 3,3–Dimethyl–6–nitrobenzo(c)(1,2)oxaborol–1(3H)–ol, 3,3-Dimethyl-6-nitrobenzo[c][1,2]oxaborol-1(3H)-ol, 98%, 98%, 3,3-DIMETHYL-6-NITROBENZO[C][1,2]OXABOROL-1(3H)-OL, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
1-hydroxy-3,3-dimethyl-6-nitro-2,1-benzoxaborole (CAS 1266084-47-2) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: 1-hydroxy-3,3-dimethyl-6-nitro-2,1-benzoxaborole. InChIKey: MUNRAMHQIFHFBM-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | 1-hydroxy-3,3-dimethyl-6-nitro-2,1-benzoxaborole |
| InChIKey | MUNRAMHQIFHFBM-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)[N+](=O)[O-])C(O1)(C)C)O |
Computed by PubChem (NCBI)