Products 1256345-61-5
CAS 1256345-61-5 appears in our catalog under these names: 5-Cyano-2-(methoxymethoxy)phenylboronic acid, 98%, (5-Cyano-2-(methoxymethoxy)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
[5-cyano-2-(methoxymethoxy)phenyl]boronic acid (CAS 1256345-61-5) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: [5-cyano-2-(methoxymethoxy)phenyl]boronic acid. InChIKey: BUHZZHJTWFVDGW-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | [5-cyano-2-(methoxymethoxy)phenyl]boronic acid |
| InChIKey | BUHZZHJTWFVDGW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C#N)OCOC)(O)O |
Computed by PubChem (NCBI)