CAS 85107-44-4 appears in our catalog under these names: 2-(3-Nitrophenyl)-1,3,2-dioxaborinane, 98%, 98%, 2-(3-Nitrophenyl)-1,3,2-dioxaborinane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2-(3-nitrophenyl)-1,3,2-dioxaborinane (CAS 85107-44-4) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: 2-(3-nitrophenyl)-1,3,2-dioxaborinane. InChIKey: KQUHPUDVXJTDHA-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | 2-(3-nitrophenyl)-1,3,2-dioxaborinane |
| InChIKey | KQUHPUDVXJTDHA-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)