CAS 1515875-37-2 appears in our catalog under these names: 4-Methyl-3-oxo-3,4-dihydro-2h-benzo[b][1,4]oxazine-7-boronic acid, 95%, (4-Methyl-3-oxo-3,4-dihydro-2H-benzo[b][1,4]oxazin-7-yl)boronic acid, 98%, 98%, 4-METHYL-3-OXO-3,4-DIHYDRO-2H-BENZO[B][1,4]OXAZINE-7-BORONIC ACID, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
(4-methyl-3-oxo-1,4-benzoxazin-7-yl)boronic acid (CAS 1515875-37-2) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: (4-methyl-3-oxo-1,4-benzoxazin-7-yl)boronic acid. InChIKey: QCCLTLCTCQLERY-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | (4-methyl-3-oxo-1,4-benzoxazin-7-yl)boronic acid |
| InChIKey | QCCLTLCTCQLERY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N(C(=O)CO2)C)(O)O |
Computed by PubChem (NCBI)