CAS 1033602-67-3 appears in our catalog under these names: [3-(Cyanomethoxy)-4-methoxyphenyl]boronic acid, 95%, (3-Cyano-4-(methoxymethoxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 1g, on request.
[3-(cyanomethoxy)-4-methoxyphenyl]boronic acid (CAS 1033602-67-3) is a chemical compound with the molecular formula C9H10BNO4 and a molecular weight of 206.99 g/mol. IUPAC name: [3-(cyanomethoxy)-4-methoxyphenyl]boronic acid. InChIKey: UJPNPYMLWKLQDS-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO4 |
|---|---|
| Molecular weight | 206.99 g/mol |
| IUPAC name | [3-(cyanomethoxy)-4-methoxyphenyl]boronic acid |
| InChIKey | UJPNPYMLWKLQDS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)OCC#N)(O)O |
Computed by PubChem (NCBI)