cas: 39616-95-0 — see every product listed under this CAS number, including other names
2-(4-fluoro-2-nitrophenyl)acetic acid, 98% (CAS 39616-95-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 5g, 25g, 1g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-4077-250mg |
| cas | 39616-95-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 258.26 Pln | |
| Fluorochem | 5g | 690.40 Pln | |
| Fluorochem | 10g | 1315.18 Pln | |
| Fluorochem | 25g | 3194.73 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-(4-fluoro-2-nitrophenyl)acetic acid (CAS 39616-95-0) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(4-fluoro-2-nitrophenyl)acetic acid. InChIKey: LAFOTQFKZXKMFD-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(4-fluoro-2-nitrophenyl)acetic acid |
| InChIKey | LAFOTQFKZXKMFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)