Products 872141-25-8
CAS 872141-25-8 appears in our catalog under these names: (3-Fluoro-2-nitrophenyl)acetic acid, 98%, 2-(3-Fluoro-2-nitrophenyl)acetic acid 97%, (3-Fluoro-2-nitrophenyl)acetic acid, 97%, 97%, 2-(3-Fluoro-2-nitrophenyl)acetic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 100mg, 250mg.
2-(3-fluoro-2-nitrophenyl)acetic acid (CAS 872141-25-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(3-fluoro-2-nitrophenyl)acetic acid. InChIKey: ZHQHUGDDYSPNTM-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(3-fluoro-2-nitrophenyl)acetic acid |
| InChIKey | ZHQHUGDDYSPNTM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)