Products 1079992-96-3
CAS 1079992-96-3 appears in our catalog under these names: 6-Fluoro-2-methyl-3-nitrobenzoic acid, 6-Fluoro-2-methyl-3-nitrobenzoic acid, 97%, 6-FLUORO-2-METHYL-3-NITROBENZOIC ACID, 98%, 6-Fluoro-2-methyl-3-nitrobenzoic acid, 98%, 98%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 0,5g, 1g, 25g, 10g, 250mg, 100mg, 500mg.
6-fluoro-2-methyl-3-nitrobenzoic acid (CAS 1079992-96-3) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 6-fluoro-2-methyl-3-nitrobenzoic acid. InChIKey: DEPIFWRMRCNBGQ-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 6-fluoro-2-methyl-3-nitrobenzoic acid |
| InChIKey | DEPIFWRMRCNBGQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1C(=O)O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)