Products 136916-19-3
CAS 136916-19-3 is the registry number for 2-(2-Fluoro-6-nitrophenyl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2-(2-fluoro-6-nitrophenyl)acetic acid (CAS 136916-19-3) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 2-(2-fluoro-6-nitrophenyl)acetic acid. InChIKey: SCRZNBSLSBQAIE-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 2-(2-fluoro-6-nitrophenyl)acetic acid |
| InChIKey | SCRZNBSLSBQAIE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-(2-Fluoro-6-nitrophenyl)acetic Acid, (2-Fluoro-6-nitro-phenyl)-acetic acid, Benzeneacetic acid, 2-fluoro-6-nitro-, 2-fluoro-6-nitroBenzeneacetic acid, (2-fluoro-6-nitrophenyl)acetic acid, SCRZNBSLSBQAIE-UHFFFAOYSA-N, 2-Fluoro-6-nitrophenylacetic acid, 2-Fluoro-6-nitro-benzeneacetic acid, 2-(2-Fluoro-6-nitrophenyl)aceticAcid, (6-fluoro-2-nitro-phenyl)-acetic acid