Products 952479-96-8
CAS 952479-96-8 appears in our catalog under these names: 5-Fluoro-3-methyl-2-nitrobenzoic acid, 96%, 5-Fluoro-3-methyl-2-nitrobenzoic acid, 97%, 5-fluoro-3-methyl-2-nitrobenzoic acid, 5-Fluoro-3-methyl-2-nitrobenzoic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
5-fluoro-3-methyl-2-nitrobenzoic acid (CAS 952479-96-8) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: 5-fluoro-3-methyl-2-nitrobenzoic acid. InChIKey: WKBHDCDQVWTTJV-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | 5-fluoro-3-methyl-2-nitrobenzoic acid |
| InChIKey | WKBHDCDQVWTTJV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1[N+](=O)[O-])C(=O)O)F |
Computed by PubChem (NCBI)