CAS 212189-78-1 appears in our catalog under these names: Methyl 2-fluoro-6-nitrobenzoate, 98%, Methyl 2–fluoro–6–nitrobenzoate, Methyl 2-fluoro-6-nitrobenzoate, 97%, 97%, Methyl 2-fluoro-6-nitrobenzoate, 97%, Methyl 2-fluoro-6-nitrobenzoate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg, 25g, 100mg.
Methyl 2-fluoro-6-nitrobenzoate (CAS 212189-78-1) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: methyl 2-fluoro-6-nitrobenzoate. InChIKey: MJARIPZQSNWYMM-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | methyl 2-fluoro-6-nitrobenzoate |
| InChIKey | MJARIPZQSNWYMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=C1F)[N+](=O)[O-] |
Computed by PubChem (NCBI)