Products 2447-23-6
CAS 2447-23-6 appears in our catalog under these names: 2-(5,7-dichloro-1H-indol-3-yl)ethan-1-amine/ 95%, 2-(5,7-dichloro-1H-indol-3-yl)ethan-1-amine. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(5,7-dichloro-1H-indol-3-yl)ethanamine (CAS 2447-23-6) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 2-(5,7-dichloro-1H-indol-3-yl)ethanamine. InChIKey: MOPMGVMKLSZZPB-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 2-(5,7-dichloro-1H-indol-3-yl)ethanamine |
| InChIKey | MOPMGVMKLSZZPB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=CN2)CCN)Cl)Cl |
Computed by PubChem (NCBI)