cas: 142667-06-9 — see every product listed under this CAS number, including other names
2-(5-(Methoxycarbonyl)thiophen-2-yl)acetic acid 95% (CAS 142667-06-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A849719-100mg |
| cas | 142667-06-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 403.75 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1254.81 Pln | |
| Ambeed | 5g | 4803.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A849719 |
2-(5-methoxycarbonylthiophen-2-yl)acetic acid (CAS 142667-06-9) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-(5-methoxycarbonylthiophen-2-yl)acetic acid. InChIKey: FWGNSHYUHXVVHJ-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(5-methoxycarbonylthiophen-2-yl)acetic acid |
| InChIKey | FWGNSHYUHXVVHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)CC(=O)O |
Computed by PubChem (NCBI)