Products 142667-06-9
CAS 142667-06-9 appears in our catalog under these names: 2-(5-(Methoxycarbonyl)thiophen-2-yl)acetic acid, 95%, 2–(5–(methoxycarbonyl)thiophen–2–yl)acetic acid, 2-(5-(Methoxycarbonyl)thiophen-2-yl)acetic acid 95%, 2-(5-(methoxycarbonyl)thiophen-2-yl)acetic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-(5-methoxycarbonylthiophen-2-yl)acetic acid (CAS 142667-06-9) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-(5-methoxycarbonylthiophen-2-yl)acetic acid. InChIKey: FWGNSHYUHXVVHJ-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(5-methoxycarbonylthiophen-2-yl)acetic acid |
| InChIKey | FWGNSHYUHXVVHJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(S1)CC(=O)O |
Computed by PubChem (NCBI)