Products 487005-05-0

CAS 487005-05-0 is the registry number for 4-(Ethoxycarbonyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-ethoxycarbonylthiophene-2-carboxylic acid (CAS 487005-05-0) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 4-ethoxycarbonylthiophene-2-carboxylic acid. InChIKey: CIKIZRQVNPXDDD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O4S
Molecular weight200.21 g/mol
IUPAC name4-ethoxycarbonylthiophene-2-carboxylic acid
InChIKeyCIKIZRQVNPXDDD-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CSC(=C1)C(=O)O

Computed by PubChem (NCBI)