CAS 3959-23-7 appears in our catalog under these names: (Phenylsulfonyl)acetic acid, 97%, (Phenylsulfonyl)acetic acid, 97% , (Phenylsulfonyl)acetic acid 98%, (Phenylsulfonyl)Acetic Acid, 96%, 96%, Phenylsulfonylacetic acid, 96%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g, 10g, 100mg, 250mg.
2-(benzenesulfonyl)acetic acid (CAS 3959-23-7) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-(benzenesulfonyl)acetic acid. InChIKey: YTEFAALYDTWTLB-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-(benzenesulfonyl)acetic acid |
| InChIKey | YTEFAALYDTWTLB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)CC(=O)O |
Computed by PubChem (NCBI)