CAS 156910-49-5 appears in our catalog under these names: 5-(Ethoxycarbonyl)thiophene-2-carboxylic acid, 95%, 5-(Ethoxycarbonyl)thiophene-2-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
5-ethoxycarbonylthiophene-2-carboxylic acid (CAS 156910-49-5) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 5-ethoxycarbonylthiophene-2-carboxylic acid. InChIKey: ZHVNYGKUJXZNOA-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 5-ethoxycarbonylthiophene-2-carboxylic acid |
| InChIKey | ZHVNYGKUJXZNOA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(S1)C(=O)O |
Computed by PubChem (NCBI)