CAS 33963-55-2 appears in our catalog under these names: 2–(Methylsulfonyl)benzoic Acid, 2-(Methylsulphonyl)benzoic acid, 2-(Methylsulfonyl)benzoic acid, 98%, 2-(Methylsulfonyl)benzoic acid, 97%, 2-(Methylsulfonyl)benzoic acid, >97%, >97%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg.
2-methylsulfonylbenzoic acid (CAS 33963-55-2) is a chemical compound with the molecular formula C8H8O4S and a molecular weight of 200.21 g/mol. IUPAC name: 2-methylsulfonylbenzoic acid. InChIKey: BZSXEZOLBIJVQK-UHFFFAOYSA-N.
| Molecular formula | C8H8O4S |
|---|---|
| Molecular weight | 200.21 g/mol |
| IUPAC name | 2-methylsulfonylbenzoic acid |
| InChIKey | BZSXEZOLBIJVQK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=CC=C1C(=O)O |
Computed by PubChem (NCBI)