cas: 692279-86-0 — see every product listed under this CAS number, including other names
2-(5-Chloro-2-ethoxy-4-formylphenoxy)acetic acid, 98% (CAS 692279-86-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g. Offered by: AmBeed, BLDpharm.
| brand | AmBeed |
|---|---|
| catalog number | A247731-10g |
| cas | 692279-86-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 8838.97 Pln | |
| AmBeed | 5g | 5974.57 Pln | |
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 687.44 Pln | |
| Ambeed | 1g | 1616.38 Pln | |
| BLDpharm | 100mg | 519.84 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1580.58 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid (CAS 692279-86-0) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: 2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid. InChIKey: OHIVEVOHOXOLRT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5 |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | 2-(5-chloro-2-ethoxy-4-formylphenoxy)acetic acid |
| InChIKey | OHIVEVOHOXOLRT-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1)C=O)Cl)OCC(=O)O |
Computed by PubChem (NCBI)