CAS 428492-17-5 is the registry number for Methyl (2-chloro-4-formyl-6-methoxyphenoxy)acetate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)acetate (CAS 428492-17-5) is a chemical compound with the molecular formula C11H11ClO5 and a molecular weight of 258.65 g/mol. IUPAC name: methyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)acetate. InChIKey: QJZYTMRHRCXSBO-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO5 |
|---|---|
| Molecular weight | 258.65 g/mol |
| IUPAC name | methyl 2-(2-chloro-4-formyl-6-methoxyphenoxy)acetate |
| InChIKey | QJZYTMRHRCXSBO-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Cl)OCC(=O)OC |
Computed by PubChem (NCBI)