cas: 261762-97-4 — see every product listed under this CAS number, including other names
2-(5-Chloro-2-fluorophenyl)acetic acid, 97%, 97% (CAS 261762-97-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113S2V-1g |
| cas | 261762-97-4 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln | |
| Chemat | 25g | 352.40 Pln | |
| Chemat | 100g | 1101.20 Pln | |
| Chemat | 500g | 4761.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(5-chloro-2-fluorophenyl)acetic acid (CAS 261762-97-4) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-(5-chloro-2-fluorophenyl)acetic acid. InChIKey: NOKLOLLCDCEFAK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-(5-chloro-2-fluorophenyl)acetic acid |
| InChIKey | NOKLOLLCDCEFAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)O)F |
Computed by PubChem (NCBI)