CAS 659737-56-1 appears in our catalog under these names: 2-Fluoro-5-methoxybenzoyl chloride, 95%, 2-Fluoro-5-methoxybenzoyl chloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-fluoro-5-methoxybenzoyl chloride (CAS 659737-56-1) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-fluoro-5-methoxybenzoyl chloride. InChIKey: SGRWKLWIQLXETK-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFO2 |
|---|---|
| Molecular weight | 188.58 g/mol |
| IUPAC name | 2-fluoro-5-methoxybenzoyl chloride |
| InChIKey | SGRWKLWIQLXETK-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)F)C(=O)Cl |
Computed by PubChem (NCBI)