Products 1427373-69-0

CAS 1427373-69-0 is the registry number for 2-Chloro-3-fluoro-5-methylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2-chloro-3-fluoro-5-methylbenzoic acid (CAS 1427373-69-0) is a chemical compound with the molecular formula C8H6ClFO2 and a molecular weight of 188.58 g/mol. IUPAC name: 2-chloro-3-fluoro-5-methylbenzoic acid. InChIKey: BPCCDJJKKDAAIC-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6ClFO2
Molecular weight188.58 g/mol
IUPAC name2-chloro-3-fluoro-5-methylbenzoic acid
InChIKeyBPCCDJJKKDAAIC-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)F)Cl)C(=O)O

Computed by PubChem (NCBI)