CAS 23464-97-3 appears in our catalog under these names: 2-(5-Phenyl-1,3-oxazol-2-yl)benzoic acid, 95%, 2-(5-Phenyloxazol-2-yl)benzoic acid, 95%, 95%, 2-(5-Phenyl-1,3-oxazol-2-yl)benzoic acid, 97%(LC-MS),RG. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-(5-phenyl-1,3-oxazol-2-yl)benzoic acid (CAS 23464-97-3) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 2-(5-phenyl-1,3-oxazol-2-yl)benzoic acid. InChIKey: HEIBWPHLFHWDAX-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 2-(5-phenyl-1,3-oxazol-2-yl)benzoic acid |
| InChIKey | HEIBWPHLFHWDAX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(O2)C3=CC=CC=C3C(=O)O |
Computed by PubChem (NCBI)