CAS 175136-53-5 is the registry number for 4-((2-Hydroxyphenyl)amino)naphthalene-1,2-dione, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-hydroxyanilino)naphthalene-1,2-dione (CAS 175136-53-5) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 4-(2-hydroxyanilino)naphthalene-1,2-dione. InChIKey: BNOCMOBNZBUGRY-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 4-(2-hydroxyanilino)naphthalene-1,2-dione |
| InChIKey | BNOCMOBNZBUGRY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=O)NC3=CC=CC=C3O |
Computed by PubChem (NCBI)